Home
>
Chemical Reagents>Heterocyclic Building Blocks> methyl 6-fluoro-2-oxo-2,3-dihydro-1H-indole-5-carboxylate
For research use only. Not for therapeutic Use.
Methyl 6-fluoro-2-oxo-2,3-dihydro-1H-indole-5-carboxylate(Cat No.:L007900), with the chemical formula C10H8FNO3. It is a compound featuring an indole ring substituted with a fluoro group at the 6-position, a carbonyl group at the 2-position, and a methyl ester group at the 5-position. Indole derivatives are essential in medicinal chemistry, often serving as key structural components in various bioactive compounds and pharmaceuticals. The presence of the fluorine atom enhances its reactivity and biological activity, making it valuable in drug discovery. Researchers explore similar compounds for their potential as therapeutic agents, contributing to advancements in the field of medicinal chemistry and drug development.
CAS Number | 1265965-97-6 |
Molecular Formula | C10H8FNO3 |
Purity | ≥95% |
IUPAC Name | methyl 6-fluoro-2-oxo-1,3-dihydroindole-5-carboxylate |
InChI | InChI=1S/C10H8FNO3/c1-15-10(14)6-2-5-3-9(13)12-8(5)4-7(6)11/h2,4H,3H2,1H3,(H,12,13) |
InChIKey | CEUOYELVDHPUAL-UHFFFAOYSA-N |
SMILES | COC(=O)C1=C(C=C2C(=C1)CC(=O)N2)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |