For research use only. Not for therapeutic Use.
Methyl 6-chloropyrimidine-4-carboxylate(Cat No.:L040561)is a chlorinated pyrimidine derivative widely used in pharmaceutical research and organic synthesis. Featuring a chlorine atom at the 6-position and a carboxylate ester group at the 4-position of the pyrimidine ring, this compound serves as a key intermediate in the development of various bioactive molecules, including antiviral and anticancer agents. Its structure makes it particularly valuable in creating heterocyclic compounds, facilitating the synthesis of complex molecular frameworks essential for drug discovery and medicinal chemistry research.
CAS Number | 6627-22-1 |
Molecular Formula | C6H5ClN2O2 |
Purity | ≥95% |
IUPAC Name | methyl 6-chloropyrimidine-4-carboxylate |
InChI | InChI=1S/C6H5ClN2O2/c1-11-6(10)4-2-5(7)9-3-8-4/h2-3H,1H3 |
InChIKey | IAEUEOUJKNGPMO-UHFFFAOYSA-N |
SMILES | COC(=O)C1=CC(=NC=N1)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |