For research use only. Not for therapeutic Use.
Methyl 6-chloroimidazo[1,2-a]pyridine-8-carboxylate(Cat No.:L043681)is a chemical compound that combines a chlorinated imidazopyridine ring with a methyl ester group. This structure makes it highly useful in pharmaceutical synthesis, especially for drugs targeting central nervous system disorders. The imidazopyridine core is noted for its bioactivity, enhancing interaction with various biological targets, while the methyl ester group increases solubility and facilitates passage through cellular membranes. The chlorine substituent further enhances the molecule’s reactivity, allowing for diverse derivatizations. This compound serves as a versatile intermediate in the development of new therapeutic agents.
| CAS Number | 760144-55-6 |
| Molecular Formula | C9H7ClN2O2 |
| Purity | ≥95% |
| IUPAC Name | methyl 6-chloroimidazo[1,2-a]pyridine-8-carboxylate |
| InChI | InChI=1S/C9H7ClN2O2/c1-14-9(13)7-4-6(10)5-12-3-2-11-8(7)12/h2-5H,1H3 |
| InChIKey | LLUZMHIRKMOZMG-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CN2C1=NC=C2)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |