For research use only. Not for therapeutic Use.
Methyl 6-amino-3-bromo-2-methylbenzoate is an aromatic ester characterized by a benzoate group with a methyl substituent at the 2-position, a bromine atom at the 3-position, and an amino group at the 6-position. This unique combination of substituents enhances its reactivity and solubility, making it valuable in organic synthesis. The amino group can participate in various chemical reactions, while the bromo and methyl groups provide additional modification opportunities. This compound may serve as an intermediate for developing pharmaceuticals and agrochemicals.
| CAS Number | 573692-58-7 |
| Molecular Formula | C9H10BrNO2 |
| Purity | ≥95% |
| IUPAC Name | methyl 6-amino-3-bromo-2-methylbenzoate |
| InChI | InChI=1S/C9H10BrNO2/c1-5-6(10)3-4-7(11)8(5)9(12)13-2/h3-4H,11H2,1-2H3 |
| InChIKey | FDOYATWYGLRGGF-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1C(=O)OC)N)Br |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |