For research use only. Not for therapeutic Use.
Methyl 6-amino-2-bromo-3-methoxybenzoate(Cat No.:L007876). This compound consists of a benzoate moiety with an amino group at the 6-position, a bromine atom at the 2-position, and a methoxy group at the 3-position. Compounds with similar structures are significant in medicinal and organic chemistry research. They serve as important intermediates in the synthesis of various pharmaceuticals, agrochemicals, and specialty chemicals. This specific compound’s unique arrangement of atoms makes it valuable for the design and development of novel compounds with potential applications in drug discovery and other scientific endeavors.
| CAS Number | 1340366-76-8 |
| Molecular Formula | C9H10BrNO3 |
| Purity | ≥95% |
| IUPAC Name | methyl 6-amino-2-bromo-3-methoxybenzoate |
| InChI | InChI=1S/C9H10BrNO3/c1-13-6-4-3-5(11)7(8(6)10)9(12)14-2/h3-4H,11H2,1-2H3 |
| InChIKey | JMHBOGOGOYQIGX-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)N)C(=O)OC)Br |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |