For research use only. Not for therapeutic Use.
Methyl 5-methylpicolinate is a methyl ester derivative of picolinic acid with a methyl group substitution at the 5-position on the pyridine ring. This structure combines the aromatic nitrogen of the pyridine with an ester functionality, making it useful in organic synthesis as a versatile intermediate. Commonly applied in pharmaceutical and agrochemical research, it serves as a building block for synthesizing bioactive molecules. Its reactivity profile enables further modifications, supporting the development of compounds for therapeutic and chemical applications.
| CAS Number | 29681-38-7 |
| Molecular Formula | C8H9NO2 |
| Purity | ≥95% |
| IUPAC Name | methyl 5-methylpyridine-2-carboxylate |
| InChI | InChI=1S/C8H9NO2/c1-6-3-4-7(9-5-6)8(10)11-2/h3-5H,1-2H3 |
| InChIKey | GLXLMXAFURBIEZ-UHFFFAOYSA-N |
| SMILES | CC1=CN=C(C=C1)C(=O)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
