Home
>
Chemical Reagents>Heterocyclic Building Blocks> Methyl 5-bromo-4H-[1,2,4]triazole-3-carboxylate
For research use only. Not for therapeutic Use.
Methyl 5-bromo-4H-[1,2,4]triazole-3-carboxylate is an organic compound with the molecular formula C₅H₆BrN₄O₂. It features a triazole ring with a bromine substituent at the 5-position and a carboxylate group at the 3-position, esterified with a methyl group. This compound typically appears as a solid and is of interest in medicinal chemistry for its potential biological activities, including antifungal and antibacterial properties. Its unique structure makes it a valuable intermediate in the synthesis of various bioactive molecules.
| CAS Number | 704911-47-7 |
| Molecular Formula | C4H4BrN3O2 |
| Purity | ≥95% |
| IUPAC Name | methyl 5-bromo-1H-1,2,4-triazole-3-carboxylate |
| InChI | InChI=1S/C4H4BrN3O2/c1-10-3(9)2-6-4(5)8-7-2/h1H3,(H,6,7,8) |
| InChIKey | GRIBRWPXKUMRDX-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NNC(=N1)Br |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |