Home
>
Chemical Reagents>Heterocyclic Building Blocks> Methyl 5-(benzyloxy)-2-methyl-1H-indole-3-carboxylate
For research use only. Not for therapeutic Use.
Methyl 5-(benzyloxy)-2-methyl-1H-indole-3-carboxylate,(CAT: L000408) is a significant compound with applications primarily in the field of organic chemistry. This molecule serves as a valuable intermediate in the synthesis of various organic compounds, particularly in the creation of specialized chemical reagents and building blocks. Its versatile structure allows for the modification and functionalization of organic molecules, making it essential for designing and producing novel compounds with tailored properties.
| CAS Number | 1671064-19-9 |
| Molecular Formula | C18H17NO3 |
| Purity | ≥95% |
| IUPAC Name | methyl 2-methyl-5-phenylmethoxy-1H-indole-3-carboxylate |
| InChI | InChI=1S/C18H17NO3/c1-12-17(18(20)21-2)15-10-14(8-9-16(15)19-12)22-11-13-6-4-3-5-7-13/h3-10,19H,11H2,1-2H3 |
| InChIKey | ISYIFHKUOVGYJP-UHFFFAOYSA-N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |