For research use only. Not for therapeutic Use.
Methyl 5-amino-4,6-dichloropicolinate(CAT: L000418) is an important compound primarily used in organic chemistry. This molecule serves as a valuable intermediate in various organic reactions and the synthesis of specialized organic compounds. Its structure, containing amino and dichloropicolinate functionalities, is instrumental in introducing specific chemical features into organic molecules, making it essential for designing and producing novel compounds with tailored properties.
CAS Number | 1805930-73-7 |
Molecular Formula | C7H6Cl2N2O2 |
Purity | ≥95% |
IUPAC Name | methyl 5-amino-4,6-dichloropyridine-2-carboxylate |
InChI | InChI=1S/C7H6Cl2N2O2/c1-13-7(12)4-2-3(8)5(10)6(9)11-4/h2H,10H2,1H3 |
InChIKey | NRVIZFGDZANPDQ-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |