For research use only. Not for therapeutic Use.
Methyl 5-amino-1H-pyrazole-3-carboxylate is a heterocyclic compound featuring an amino group at the 5-position and a carboxylate ester at the 3-position of a pyrazole ring. This compound is valuable in medicinal chemistry and organic synthesis due to its potential biological activities, including anti-inflammatory and antimicrobial properties. The carboxylate ester and amino group provide reactive sites for further chemical modifications, making it a useful intermediate in the development of pharmaceuticals and bioactive molecules for drug discovery and research applications.
CAS Number | 632365-54-9 |
Molecular Formula | C5H7N3O2 |
Purity | ≥95% |
IUPAC Name | methyl 3-amino-1H-pyrazole-5-carboxylate |
InChI | InChI=1S/C5H7N3O2/c1-10-5(9)3-2-4(6)8-7-3/h2H,1H3,(H3,6,7,8) |
InChIKey | WUKSVVOCYHTIMV-UHFFFAOYSA-N |
SMILES | COC(=O)C1=CC(=NN1)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |