Home
>
Chemical Reagents>Heterocyclic Building Blocks> Methyl 5-(2,4-difluorophenyl)isoxazole-3-carboxylate
For research use only. Not for therapeutic Use.
Methyl 5-(2,4-difluorophenyl)isoxazole-3-carboxylate is an isoxazole derivative featuring a carboxylate group at the 3-position and a 2,4-difluorophenyl substituent at the 5-position. This compound exhibits unique electronic properties due to the presence of the difluorophenyl group, enhancing its reactivity and potential biological activity. It serves as a valuable intermediate in organic synthesis, particularly for developing pharmaceuticals and agrochemicals. The isoxazole moiety allows for various modifications, facilitating the exploration of structure-activity relationships in medicinal chemistry and related fields.
CAS Number | 1105191-49-8 |
Molecular Formula | C11H7F2NO3 |
Purity | ≥95% |
IUPAC Name | methyl 5-(2,4-difluorophenyl)-1,2-oxazole-3-carboxylate |
InChI | InChI=1S/C11H7F2NO3/c1-16-11(15)9-5-10(17-14-9)7-3-2-6(12)4-8(7)13/h2-5H,1H3 |
InChIKey | FVQQUERDPUGSJW-UHFFFAOYSA-N |
SMILES | COC(=O)C1=NOC(=C1)C2=C(C=C(C=C2)F)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |