For research use only. Not for therapeutic Use.
Methyl 4,6-dihydroxypyridazine-3-carboxylate(CAT: L039750) is an organic compound that features a pyridazine ring with hydroxyl groups at the 4th and 6th positions, and a methyl ester at the 3rd position. This structure makes it useful in organic synthesis, particularly in medicinal chemistry, where it can serve as a building block for the design of bioactive molecules. The hydroxyl groups can participate in hydrogen bonding and nucleophilic substitution reactions, while the ester group allows for further functionalization, such as hydrolysis to the corresponding carboxylic acid. This compound’s pyridazine core is commonly explored in the development of pharmaceuticals due to its relevance in heterocyclic chemistry and potential biological activities.
CAS Number | 372118-00-8 |
Molecular Formula | C6H6N2O4 |
Purity | ≥95% |
IUPAC Name | methyl 4-hydroxy-6-oxo-1H-pyridazine-3-carboxylate |
InChI | InChI=1S/C6H6N2O4/c1-12-6(11)5-3(9)2-4(10)7-8-5/h2H,1H3,(H2,7,9,10) |
InChIKey | SHJHUIKJFYHTDY-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |