For research use only. Not for therapeutic Use.
Methyl 4,6-dichloro-2-methylnicotinate(CAT: L019673) is a chlorinated derivative of nicotinic acid, featuring two chlorine atoms at the 4- and 6-positions of the pyridine ring, along with a methyl ester group at the carboxyl position. This compound is commonly used as an intermediate in the synthesis of pharmaceuticals and agrochemicals. The chlorine substituents enhance its reactivity, particularly in nucleophilic substitution reactions, allowing for further functionalization. Additionally, the methyl ester group provides versatility for subsequent chemical modifications, such as hydrolysis to form the corresponding acid. This compound is valuable in drug development, especially for creating bioactive heterocyclic compounds due to the pyridine ring’s presence in many pharmaceutical agents.
| CAS Number | 1196073-28-5 |
| Molecular Formula | C8H7Cl2NO2 |
| Purity | ≥95% |
| IUPAC Name | methyl 4,6-dichloro-2-methylpyridine-3-carboxylate |
| InChI | InChI=1S/C8H7Cl2NO2/c1-4-7(8(12)13-2)5(9)3-6(10)11-4/h3H,1-2H3 |
| InChIKey | HTVAJMUKCKPSHB-UHFFFAOYSA-N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |