Methyl 4-toluenesulfonate is a widely used reagent in organic synthesis, valued for its role as a sulfonate leaving group in nucleophilic substitution reactions. Featuring a methyl group and a para-toluenesulfonyl moiety, this compound enhances reactivity and facilitates the formation of various carbon-carbon and carbon-heteroatom bonds. Its stability and ease of use make it a preferred choice in the synthesis of complex molecules, including pharmaceuticals and agrochemicals. Methyl 4-toluenesulfonate is essential for advancing synthetic methodologies in chemical research.
| Catalog Number | R069507 |
| CAS Number | 80-48-8 |
| Synonyms | Methyl tosylate, METHYL-P-TOLUENESULFONATE |
| Molecular Formula | C8H10O3S |
| Purity | ≥95% |
| Storage | RT |
| IUPAC Name | methyl 4-methylbenzenesulfonate |
| InChI | InChI=1S/C8H10O3S/c1-7-3-5-8(6-4-7)12(9,10)11-2/h3-6H,1-2H3 |
| InChIKey | VUQUOGPMUUJORT-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OC |
