For research use only. Not for therapeutic Use.
Methyl 4-oxocyclohexanecarboxylate is an organic compound featuring a cyclohexane ring with a ketone and ester functional group. This compound is of interest in organic synthesis due to its versatility as a building block for various chemical transformations. Its structure enables it to participate in reactions such as esterification and cyclization, making it valuable in the development of pharmaceuticals and agrochemicals. Researchers explore its applications in synthesizing novel compounds, highlighting its potential in medicinal chemistry and material science.
CAS Number | 6297-22-9 |
Synonyms | 4-oxo-Cyclohexanecarboxylic Acid Methyl Ester; 4-(Methoxycarbonyl)cyclohexanone; Methyl 4-Ketocyclohexanecarboxylate; Methyl cyclohexanone-4-carboxylate; NSC 17321; |
Molecular Formula | C8H12O3 |
Purity | ≥95% |
Storage | -20 ℃ |
IUPAC Name | methyl 4-oxocyclohexane-1-carboxylate |
InChI | InChI=1S/C8H12O3/c1-11-8(10)6-2-4-7(9)5-3-6/h6H,2-5H2,1H3 |
InChIKey | BLYKGTCYDJZLFB-UHFFFAOYSA-N |
SMILES | COC(=O)C1CCC(=O)CC1 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |