For research use only. Not for therapeutic Use.
Methyl 4-fluoro-1H-indole-7-carboxylate is a fluorinated indole derivative commonly used in pharmaceutical research and organic synthesis. Its structure, featuring a 4-fluoro group and a carboxylate ester at the 7-position of the indole ring, makes it a valuable intermediate in the development of bioactive molecules. This compound is often employed in the synthesis of therapeutic agents, including anticancer and anti-inflammatory drugs. Its reactivity and versatility allow for various chemical modifications, supporting advancements in medicinal chemistry and drug discovery.
| CAS Number | 313337-35-8 |
| Molecular Formula | C10H8FNO2 |
| Purity | ≥95% |
| IUPAC Name | methyl 4-fluoro-1H-indole-7-carboxylate |
| InChI | InChI=1S/C10H8FNO2/c1-14-10(13)7-2-3-8(11)6-4-5-12-9(6)7/h2-5,12H,1H3 |
| InChIKey | HEQXLRSGYSDTAZ-UHFFFAOYSA-N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |