For research use only. Not for therapeutic Use.
Methyl 4-chloro-2-(trifluoromethyl)benzoate（Cat No.:L020144）is a versatile chemical intermediate commonly used in organic synthesis, particularly within the pharmaceutical and agrochemical industries. This compound features a chloro and trifluoromethyl group attached to a benzoate ester, providing unique reactivity that is valuable for constructing complex molecular frameworks. It is often utilized in the development of active pharmaceutical ingredients (APIs), offering a key building block for various synthesis pathways. Its high purity and stability make it an essential tool for researchers and chemists working on innovative drug discovery and development projects.
| CAS Number | 115591-65-6 |
| Molecular Formula | C9H6ClF3O2 |
| Purity | ≥95% |
| IUPAC Name | methyl 4-chloro-2-(trifluoromethyl)benzoate |
| InChI | InChI=1S/C9H6ClF3O2/c1-15-8(14)6-3-2-5(10)4-7(6)9(11,12)13/h2-4H,1H3 |
| InChIKey | NHOXZNZUKPMTMA-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)Cl)C(F)(F)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
