For research use only. Not for therapeutic Use.
Methyl 4-acetylbenzoate(Cat No.:L047012)is an aromatic ester featuring a methyl ester group (–COOCH₃) at the 1-position and an acetyl group (–COCH₃) at the 4-position of a benzene ring. This compound appears as a pale yellow to colorless liquid or solid and is commonly used as an intermediate in organic synthesis, particularly in pharmaceuticals, agrochemicals, and dyes. The presence of both electron-withdrawing groups influences the reactivity of the aromatic ring, enabling selective substitutions. Its ester and ketone functionalities allow for further derivatization, making it valuable in multi-step synthetic pathways.
| CAS Number | 3609-53-8 |
| Molecular Formula | C10H10O3 |
| Purity | ≥95% |
| IUPAC Name | methyl 4-acetylbenzoate |
| InChI | InChI=1S/C10H10O3/c1-7(11)8-3-5-9(6-4-8)10(12)13-2/h3-6H,1-2H3 |
| InChIKey | QNTSFZXGLAHYLC-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)C(=O)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |