For research use only. Not for therapeutic Use.
Methyl 4-(2-chloro-4-hydroxystyryl)benzoate(CAT: L025834) is a high-purity aromatic compound featuring a chlorohydroxy styryl group attached to a benzoate ester core. This versatile molecule serves as a valuable intermediate in pharmaceutical research and organic synthesis, particularly in the development of bioactive compounds, including anti-inflammatory agents and other therapeutic candidates. Its unique structure, containing both hydroxyl and chloro functionalities, allows for selective modifications, enabling advanced chemical transformations. Methyl 4-(2-chloro-4-hydroxystyryl)benzoate exhibits excellent stability and reactivity, making it a critical building block for medicinal chemistry, material science, and the synthesis of complex organic frameworks.
CAS Number | 1268246-12-3 |
Molecular Formula | C16H13ClO3 |
Purity | ≥95% |
IUPAC Name | methyl 4-[(E)-2-(2-chloro-4-hydroxyphenyl)ethenyl]benzoate |
InChI | InChI=1S/C16H13ClO3/c1-20-16(19)13-6-3-11(4-7-13)2-5-12-8-9-14(18)10-15(12)17/h2-10,18H,1H3/b5-2+ |
InChIKey | ATGFXXLXIGQIDG-GORDUTHDSA-N |
SMILES | COC(=O)C1=CC=C(C=C1)/C=C/C2=C(C=C(C=C2)O)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |