For research use only. Not for therapeutic Use.
Methyl 3,6-di-O-(α-D-mannopyranosyl)-α-D-mannopyranoside(Cat No.:R000229) is a complex carbohydrate molecule consisting of two α-D-mannopyranosyl units linked together in a specific configuration. It is commonly used as a synthetic substrate in enzymatic assays to study enzymes that hydrolyze or modify similar carbohydrate structures. This compound is also employed in the synthesis of more complex oligosaccharides and glycoconjugates for use in chemical biology and glycobiology research. The precise arrangement of mannopyranosyl units in this molecule makes it a valuable tool for investigating the substrate specificity and catalytic mechanisms of enzymes involved in carbohydrate metabolism and modification.
| CAS Number | 68601-74-1 |
| Synonyms | Man1-α-6[Man1-α-3]Man-α-OMe; Methyl O-α-D-Mannopyranosyl-(1→3)-O-?[α-D-mannopyranosyl-(1→6)]-α-D-mannopyranoside; |
| Molecular Formula | C₁₉H₃₄O₁₆ |
| Purity | ≥95% |
| Storage | Store at -20°C |
| IUPAC Name | 2-[[3,5-dihydroxy-6-methoxy-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| InChI | InChI=1S/C19H34O16/c1-30-17-15(29)16(35-19-14(28)12(26)9(23)6(3-21)33-19)10(24)7(34-17)4-31-18-13(27)11(25)8(22)5(2-20)32-18/h5-29H,2-4H2,1H3 |
| InChIKey | DCXPDWNLLMVYGH-UHFFFAOYSA-N |
| SMILES | COC1C(C(C(C(O1)COC2C(C(C(C(O2)CO)O)O)O)O)OC3C(C(C(C(O3)CO)O)O)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |