For research use only. Not for therapeutic Use.
Methyl 3-isocyanatobenzoate(Cat No.:L006998), is an organic compound used in the synthesis of specialty chemicals and polymers. It consists of a benzoate group with an isocyanate functional group attached. This compound is employed as a versatile intermediate in organic synthesis, particularly in the production of polyurethane resins, adhesives, and coatings. Its reactivity allows it to crosslink with various compounds, forming durable materials with excellent adhesion properties. Methyl 3-isocyanatobenzoate is valuable in the development of coatings for automotive, aerospace, and industrial applications, contributing to the creation of high-performance polymeric materials in research and industrial sectors.
| CAS Number | 41221-47-0 |
| Molecular Formula | C9H7NO3 |
| Purity | ≥95% |
| Storage | 0-6°C |
| IUPAC Name | methyl 3-isocyanatobenzoate |
| InChI | InChI=1S/C9H7NO3/c1-13-9(12)7-3-2-4-8(5-7)10-6-11/h2-5H,1H3 |
| InChIKey | WBGWGERFPSYHDT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CC=C1)N=C=O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |