For research use only. Not for therapeutic Use.
Methyl 3-hydroxycyclobutanecarboxylate(CAT: L039898) is a versatile cyclobutane-based compound featuring a hydroxyl group and a methyl ester functional group. Its strained four-membered ring structure offers unique reactivity, making it an attractive intermediate in the synthesis of complex molecules, including bioactive natural products and pharmaceutical candidates. The hydroxyl moiety allows for further derivatization, such as esterification or etherification, while the ester group facilitates coupling reactions. This compound is especially useful in medicinal chemistry for exploring conformationally restricted analogs of larger cyclic systems. Its high purity and reliable performance make it ideal for synthetic applications in drug discovery and fine chemical development.
| CAS Number | 4934-99-0 |
| Molecular Formula | C6H10O3 |
| Purity | ≥95% |
| IUPAC Name | methyl 3-hydroxycyclobutane-1-carboxylate |
| InChI | InChI=1S/C6H10O3/c1-9-6(8)4-2-5(7)3-4/h4-5,7H,2-3H2,1H3 |
| InChIKey | BYKHAEUVLSBWSU-UHFFFAOYSA-N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
