For research use only. Not for therapeutic Use.
Methyl 3-bromo-2-fluoroisonicotinate(Cat No.:L006764). It features a nicotinate (pyridine-3-carboxylate) backbone substituted with a bromine atom at the 3-position and a fluorine atom at the 2-position. This compound is essential in pharmaceutical research and organic synthesis, often used as a key building block to create complex molecules for drug discovery. Its unique structure allows for diverse chemical transformations, enabling the development of potential drug candidates. Researchers utilize it as a versatile intermediate in the preparation of various biologically active compounds, contributing to advancements in medicinal chemistry and drug development.
| CAS Number | 1214325-32-2 |
| Molecular Formula | C7H5BrFNO2 |
| Purity | ≥95% |
| IUPAC Name | methyl 3-bromo-2-fluoropyridine-4-carboxylate |
| InChI | InChI=1S/C7H5BrFNO2/c1-12-7(11)4-2-3-10-6(9)5(4)8/h2-3H,1H3 |
| InChIKey | JBQRECAJGREBGX-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=NC=C1)F)Br |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |