For research use only. Not for therapeutic Use.
Methyl 3-amino-5-chloro-2-methylbenzoate(CAT: L037677) is a versatile aromatic compound used in the synthesis of pharmaceuticals and fine chemicals. Featuring an ester functional group along with amino, chloro, and methyl substituents on the benzene ring, it offers valuable reactivity for the development of bioactive molecules and intermediates. This compound is particularly useful in medicinal chemistry for designing anti-inflammatory, antimicrobial, or CNS-targeted agents due to its structural resemblance to biologically relevant frameworks. Its balanced solubility and chemical stability make it suitable for diverse synthetic applications, including fragment-based drug design and advanced organic transformations in both academic and industrial research settings.
| CAS Number | 294190-18-4 |
| Molecular Formula | C9H10ClNO2 |
| Purity | ≥95% |
| IUPAC Name | methyl 3-amino-5-chloro-2-methylbenzoate |
| InChI | InChI=1S/C9H10ClNO2/c1-5-7(9(12)13-2)3-6(10)4-8(5)11/h3-4H,11H2,1-2H3 |
| InChIKey | RGXZOGNUNHYYLK-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1N)Cl)C(=O)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
