For research use only. Not for therapeutic Use.
Methyl 3-(1,3,2-dioxaborinan-2-yl)benzoate(CAT: L000357) is a valuable organoboron compound that finds essential applications in the field of organic chemistry. This compound is widely employed in various synthetic reactions, such as Suzuki-Miyaura cross-coupling, enabling the efficient construction of complex organic molecules. The boron-containing dioxaborinane moiety imparts unique reactivity to the compound, making it a versatile building block for designing and modifying organic structures.
| CAS Number | 2222401-85-4 |
| Molecular Formula | C11H13BO4 |
| Purity | ≥95% |
| IUPAC Name | methyl 3-(1,3,2-dioxaborinan-2-yl)benzoate |
| InChI | InChI=1S/C11H13BO4/c1-14-11(13)9-4-2-5-10(8-9)12-15-6-3-7-16-12/h2,4-5,8H,3,6-7H2,1H3 |
| InChIKey | APSGWMCVRPVUGQ-UHFFFAOYSA-N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |