For research use only. Not for therapeutic Use.
Methyl 2,5-dihydroxycinnamate（Cat No.:R000230）is a cinnamic acid derivative known for its antioxidant, anti-inflammatory, and potential anticancer properties. Structurally characterized by hydroxyl groups at the 2 and 5 positions of the aromatic ring, it exhibits radical-scavenging activity, making it relevant in oxidative stress-related studies. This compound is often investigated for its ability to modulate cellular signaling pathways and inhibit pro-inflammatory mediators. Its natural product-like structure also makes it a candidate for drug development and synthetic chemistry research. Methyl 2,5-dihydroxycinnamate is valuable in pharmacological and biochemical exploration of phenolic compounds.
| CAS Number | 63177-57-1 |
| Synonyms | methyl (E)-3-(2,5-dihydroxyphenyl)prop-2-enoate |
| Molecular Formula | C10H10O4 |
| Purity | ≥95% |
| IUPAC Name | methyl (E)-3-(2,5-dihydroxyphenyl)prop-2-enoate |
| InChI | InChI=1S/C10H10O4/c1-14-10(13)5-2-7-6-8(11)3-4-9(7)12/h2-6,11-12H,1H3/b5-2+ |
| InChIKey | BQCNSTFWSKOWMA-GORDUTHDSA-N |
| SMILES | COC(=O)/C=C/C1=C(C=CC(=C1)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
