For research use only. Not for therapeutic Use.
Methyl 2-(Naphthalen-2-yl)acetate(Cat No.:L007072), is an organic compound used in organic synthesis and medicinal chemistry. It contains an acetyl group (-COCH3) attached to a naphthalene ring through a methylene bridge. This compound serves as a valuable building block in the creation of diverse organic molecules, particularly in the development of pharmaceuticals and agrochemicals. Its unique structure and reactivity enable the synthesis of complex and biologically active compounds.
| CAS Number | 2876-71-3 |
| Molecular Formula | C13H12O2 |
| Purity | ≥95% |
| IUPAC Name | methyl 2-naphthalen-2-ylacetate |
| InChI | InChI=1S/C13H12O2/c1-15-13(14)9-10-6-7-11-4-2-3-5-12(11)8-10/h2-8H,9H2,1H3 |
| InChIKey | BGYOCQOJCMPTCY-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1=CC2=CC=CC=C2C=C1 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |