For research use only. Not for therapeutic Use.
Methyl 2-iodo-5-methoxybenzoate(Cat No.:L035303)is a high-purity iodinated ester used extensively in pharmaceutical research and organic synthesis. Featuring an iodine atom at the 2-position and a methoxy group at the 5-position on the benzoate ring, this compound is essential for the synthesis of complex organic molecules, particularly in drug development and the creation of fine chemicals. Its unique structure allows for targeted chemical reactions, making it a valuable intermediate in medicinal chemistry. Methyl 2-iodo-5-methoxybenzoate ensures consistent performance in advanced synthetic applications.
CAS Number | 857599-37-2 |
Molecular Formula | C9H9IO3 |
Purity | ≥95% |
IUPAC Name | methyl 2-iodo-5-methoxybenzoate |
InChI | InChI=1S/C9H9IO3/c1-12-6-3-4-8(10)7(5-6)9(11)13-2/h3-5H,1-2H3 |
InChIKey | RDRCCNSFEFSPTO-UHFFFAOYSA-N |
SMILES | COC1=CC(=C(C=C1)I)C(=O)OC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |