For research use only. Not for therapeutic Use.
Methyl 2-(chlorosulfonyl)benzoate(Cat No.:L011261)is an aromatic compound featuring a methyl ester group at the 1-position and a chlorosulfonyl group (–SO₂Cl) at the 2-position of a benzoic acid core. This dual-functional molecule combines the reactivity of both ester and sulfonyl chloride groups, making it highly versatile in organic synthesis. The chlorosulfonyl group is particularly reactive toward amines and alcohols, allowing for the formation of sulfonamides and sulfonate esters, while the ester can undergo typical nucleophilic substitutions or hydrolysis. It is commonly used as an intermediate in the synthesis of pharmaceuticals, dyes, and advanced materials.
CAS Number | 26638-43-7 |
Molecular Formula | C8H7ClO4S |
Purity | ≥95% |
IUPAC Name | methyl 2-chlorosulfonylbenzoate |
InChI | InChI=1S/C8H7ClO4S/c1-13-8(10)6-4-2-3-5-7(6)14(9,11)12/h2-5H,1H3 |
InChIKey | HUNUAFNLLYVTQD-UHFFFAOYSA-N |
SMILES | COC(=O)C1=CC=CC=C1S(=O)(=O)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |