For research use only. Not for therapeutic Use.
Methyl 2-chloropyrimidine-5-carboxylate(CAT: L045980) is a chlorinated pyrimidine ester featuring a chlorine atom at the 2-position and a methyl ester at the 5-carboxylate position. This compound is a valuable intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The 2-chloro substituent on the pyrimidine ring allows for selective nucleophilic substitution reactions, enabling the introduction of various functional groups and creating diverse pyrimidine derivatives. The methyl ester group can be hydrolyzed or modified in subsequent reactions, making this compound versatile for synthesizing bioactive molecules, such as enzyme inhibitors, antimicrobial agents, and crop protection chemicals. Researchers use it as a building block for expanding chemical libraries and designing compounds with potential biological activities.
CAS Number | 287714-35-6 |
Molecular Formula | C6H5ClN2O2 |
Purity | ≥95% |
IUPAC Name | methyl 2-chloropyrimidine-5-carboxylate |
InChI | InChI=1S/C6H5ClN2O2/c1-11-5(10)4-2-8-6(7)9-3-4/h2-3H,1H3 |
InChIKey | VJOKXLBQCKCWLV-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |