For research use only. Not for therapeutic Use.
Methyl 2-butynoate(CAT: L012557) is a versatile alkyne ester featuring a triple bond conjugated to an ester group, making it a valuable intermediate in organic synthesis. Its electrophilic ester moiety and reactive alkyne functionality allow for diverse transformations, including nucleophilic additions, cycloadditions, and metal-catalyzed coupling reactions. This compound is commonly used in the development of pharmaceuticals, agrochemicals, and advanced materials. Its compact structure enables it to serve as a key building block in constructing more complex molecular architectures, including heterocycles and functionalized polymers. Methyl 2-butynoate is particularly useful in research focused on developing novel reaction methodologies and bioactive compounds.
| CAS Number | 23326-27-4 |
| Molecular Formula | C5H6O2 |
| Purity | ≥95% |
| IUPAC Name | methyl but-2-ynoate |
| InChI | InChI=1S/C5H6O2/c1-3-4-5(6)7-2/h1-2H3 |
| InChIKey | UJQCANQILFWSDJ-UHFFFAOYSA-N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
