For research use only. Not for therapeutic Use.
Methyl 2-amino-5-bromo-4-methoxybenzoate is an organic compound with the molecular formula C₉H₈BrN₃O₂. It features a benzoate structure with a methoxy group, an amino group, and a bromine substituent. This compound appears as a solid and is of interest in pharmaceutical chemistry due to its potential as a building block in drug synthesis. Its unique functional groups may enhance its biological activity, making it relevant in the development of various bioactive compounds, particularly in the search for new therapeutic agents.
CAS Number | 169044-96-6 |
Molecular Formula | C9H10BrNO3 |
Purity | ≥95% |
IUPAC Name | methyl 2-amino-5-bromo-4-methoxybenzoate |
InChI | InChI=1S/C9H10BrNO3/c1-13-8-4-7(11)5(3-6(8)10)9(12)14-2/h3-4H,11H2,1-2H3 |
InChIKey | SFXCMXLNSVHKCE-UHFFFAOYSA-N |
SMILES | COC1=C(C=C(C(=C1)N)C(=O)OC)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |