For research use only. Not for therapeutic Use.
Methyl 2-amino-4-chloro-5-methoxybenzoate(CAT: L025401) is a versatile compound used in pharmaceutical and chemical research, especially as an intermediate in the synthesis of complex organic molecules. Its structure includes an amino group, a chlorine atom, and a methoxy group attached to a benzoate core, creating a unique profile of reactivity and functional versatility. The compound’s amino and ester groups make it suitable for various coupling reactions, allowing it to act as a precursor in developing bioactive compounds. With its specific electronic properties, Methyl 2-amino-4-chloro-5-methoxybenzoate is often incorporated into synthesis pathways aimed at producing therapeutic candidates, offering valuable functionality for medicinal chemistry applications.
CAS Number | 181434-36-6 |
Molecular Formula | C9H10ClNO3 |
Purity | ≥95% |
IUPAC Name | methyl 2-amino-4-chloro-5-methoxybenzoate |
InChI | InChI=1S/C9H10ClNO3/c1-13-8-3-5(9(12)14-2)7(11)4-6(8)10/h3-4H,11H2,1-2H3 |
InChIKey | AQLRQXBTXPAANE-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |