For research use only. Not for therapeutic Use.
Methyl 2-amino-4-bromo-6-fluorobenzoate(Cat No.:L022753)is a halogenated aromatic ester notable for its structural diversity and reactivity, featuring amino, bromo, and fluoro substituents on a benzoate ring. This compound is pivotal in pharmaceutical and material science research, often used as a building block for synthesizing complex molecules. The presence of bromo and fluoro groups enhances its reactivity, making it suitable for various organic transformations, including coupling reactions. It is essential for creating novel drug candidates, particularly in the development of anticancer and antibacterial agents.
CAS Number | 1698028-23-7 |
Molecular Formula | C8H7BrFNO2 |
Purity | ≥95% |
IUPAC Name | methyl 2-amino-4-bromo-6-fluorobenzoate |
InChI | InChI=1S/C8H7BrFNO2/c1-13-8(12)7-5(10)2-4(9)3-6(7)11/h2-3H,11H2,1H3 |
InChIKey | RBMIFLUDJHVUDS-UHFFFAOYSA-N |
SMILES | COC(=O)C1=C(C=C(C=C1F)Br)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |