For research use only. Not for therapeutic Use.
Methyl 2-amino-4-bromo-5-methoxybenzoate is an organic compound featuring a benzoate structure with an amino group at the second position, a bromine atom at the fourth position, and a methoxy group (-OCH₃) at the fifth position. Its chemical formula is C₉H₈BrN₁O₃. This compound is of interest in medicinal chemistry due to its potential biological activities, including antitumor and anti-inflammatory properties. The combination of functional groups enhances its reactivity, making it a valuable scaffold for drug development and synthetic applications.
| CAS Number | 1256955-36-8 |
| Molecular Formula | C9H10BrNO3 |
| Purity | ≥95% |
| IUPAC Name | methyl 2-amino-4-bromo-5-methoxybenzoate |
| InChI | InChI=1S/C9H10BrNO3/c1-13-8-3-5(9(12)14-2)7(11)4-6(8)10/h3-4H,11H2,1-2H3 |
| InChIKey | VLYQTTVQFZRGQX-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)C(=O)OC)N)Br |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |