For research use only. Not for therapeutic Use.
Methyl 2-(2-pyrimidyl)acetate is an aromatic ester characterized by a pyrimidine ring at the 2-position of an acetate moiety. This compound exhibits valuable chemical properties due to its unique structure, making it useful in organic synthesis and medicinal chemistry. The methyl ester group allows for various transformations, such as hydrolysis and esterification, while the pyrimidyl substituent can influence biological activity and reactivity. This compound may serve as an important intermediate in the synthesis of pharmaceuticals and in exploring structure-activity relationships.
CAS Number | 60561-50-4 |
Molecular Formula | C7H8N2O2 |
Purity | ≥95% |
IUPAC Name | methyl 2-pyrimidin-2-ylacetate |
InChI | InChI=1S/C7H8N2O2/c1-11-7(10)5-6-8-3-2-4-9-6/h2-4H,5H2,1H3 |
InChIKey | ZDUBLLCAMMIGFH-UHFFFAOYSA-N |
SMILES | COC(=O)CC1=NC=CC=N1 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |