For research use only. Not for therapeutic Use.
Methyl 16-bromohexadecanoate（Cat No.:L007001）, is an organic compound utilized in chemical synthesis and research. It is a fatty acid derivative containing a bromine atom, making it a valuable reagent in the production of lipids, surfactants, and other complex organic molecules. This compound serves as a key intermediate in the synthesis of biologically active compounds, pharmaceuticals, and agrochemicals. Its specific structure contributes to its role in studying lipid metabolism and biological processes.
| CAS Number | 26825-89-8 |
| Molecular Formula | C17H33BrO2 |
| Purity | ≥95% |
| IUPAC Name | methyl 16-bromohexadecanoate |
| InChI | InChI=1S/C17H33BrO2/c1-20-17(19)15-13-11-9-7-5-3-2-4-6-8-10-12-14-16-18/h2-16H2,1H3 |
| InChIKey | ZYTQDEJMRYPSHE-UHFFFAOYSA-N |
| SMILES | COC(=O)CCCCCCCCCCCCCCCBr |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
