For research use only. Not for therapeutic Use.
meso-Tetrakis(α-naphthyl)porphyrin(CAT: L000298) is a compound of importance in material chemistry and the field of organic chemistry. This chemical is used in the synthesis of specialized organic molecules and materials. Its action method involves serving as a building block for the creation of various organic compounds and materials. In material chemistry, it is instrumental in designing functional materials, often employed in the development of advanced materials with unique properties.
| CAS Number | 132055-60-8 |
| Molecular Formula | C60H38N4 |
| Purity | ≥95% |
| IUPAC Name | 5,10,15,20-tetranaphthalen-2-yl-21,23-dihydroporphyrin |
| InChI | InChI=1S/C60H38N4/c1-5-13-41-33-45(21-17-37(41)9-1)57-49-25-27-51(61-49)58(46-22-18-38-10-2-6-14-42(38)34-46)53-29-31-55(63-53)60(48-24-20-40-12-4-8-16-44(40)36-48)56-32-30-54(64-56)59(52-28-26-50(57)62-52)47-23-19-39-11-3-7-15-43(39)35-47/h1-36,61,64H |
| InChIKey | YVPGTGPKNRAZFI-UHFFFAOYSA-N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |