For research use only. Not for therapeutic Use.
Meso-1,2-diphenyl ethylenediamine (Cat No.:L007004), is an organic compound used in various chemical applications. It is a symmetrical diamine with two phenyl groups attached to the nitrogen atoms. This compound finds utility as a ligand in coordination chemistry, facilitating the formation of metal complexes. Researchers utilize meso-1,2-diphenyl ethylenediamine in catalysis, asymmetric synthesis, and organometallic reactions due to its chelating properties. Its unique structure enables the development of diverse organic and coordination compounds, making it valuable in both academic research and industrial processes, contributing significantly to the advancement of coordination and organometallic chemistry.
CAS Number | 951-87-1 |
Molecular Formula | C14H16N2 |
Purity | ≥95% |
IUPAC Name | (1R,2S)-1,2-diphenylethane-1,2-diamine |
InChI | InChI=1S/C14H16N2/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-10,13-14H,15-16H2/t13-,14+ |
InChIKey | PONXTPCRRASWKW-OKILXGFUSA-N |
SMILES | C1=CC=C(C=C1)C(C(C2=CC=CC=C2)N)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |