For research use only. Not for therapeutic Use.
Mesitylcopper(I)（Cat No.:L002345）is an organocopper compound with the formula Cu(C₆H₂(C₆H₃)₃), where mesityl (1,3,5-trimethylphenyl) groups are bonded to the copper center. This compound is often used as a reagent or catalyst in organic synthesis, particularly in cross-coupling reactions such as the Heck reaction, Ullmann coupling, and other carbon-carbon bond-forming processes. The mesityl groups provide steric protection to the copper center, increasing its stability and reactivity. Mesitylcopper(I) is utilized in the preparation of complex organic molecules and is valuable in catalysis and materials science.
| CAS Number | 75732-01-3 |
| Molecular Formula | C9H11Cu |
| Purity | ≥95% |
| IUPAC Name | copper(1+);1,3,5-trimethylbenzene-6-ide |
| InChI | InChI=1S/C9H11.Cu/c1-7-4-8(2)6-9(3)5-7;/h4-5H,1-3H3;/q-1;+1 |
| InChIKey | TYIFJJCPKPPNPM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=[C-]C(=C1)C)C.[Cu+] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
