For research use only. Not for therapeutic Use.
Menaquinone-9 (Cat No.: R012973) is a form of vitamin K₂, characterized by a side chain containing nine isoprenoid units. It is produced by bacteria and plays a critical role in the electron transport chain of certain prokaryotes. In humans, menaquinones, including MK-9, contribute to blood clotting, bone metabolism, and cardiovascular health by activating vitamin K-dependent proteins. MK-9 is typically found in fermented foods and some animal products. Its long side chain offers greater lipophilicity, potentially affecting bioavailability and tissue distribution.
| CAS Number | 523-39-7 |
| Synonyms | 2-Methyl-3-[(2E,6E,10E,14E,18E,22E,26E,30E)-3,7,11,15,19,23,27,31,35-nonamethyl-2,6,10,14,18,22,26,30,34-hexatriacontanonaen-1-yl]-1,4-naphthalenedione; Vitamin K2(45) (6CI); MK9; Menaquinone MK 9; Vitamin MK 9; ? |
| Molecular Formula | C₅₆H₈₀O₂ |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 2-methyl-3-[(2E,6E,10E,14E,18E,22E,26E,30E)-3,7,11,15,19,23,27,31,35-nonamethylhexatriaconta-2,6,10,14,18,22,26,30,34-nonaenyl]naphthalene-1,4-dione |
| InChI | InChI=1S/C56H80O2/c1-42(2)22-14-23-43(3)24-15-25-44(4)26-16-27-45(5)28-17-29-46(6)30-18-31-47(7)32-19-33-48(8)34-20-35-49(9)36-21-37-50(10)40-41-52-51(11)55(57)53-38-12-13-39-54(53)56(52)58/h12-13,22,24,26,28,30,32,34,36,38-40H,14-21,23,25,27,29,31,33,35,37,41H2,1-11H3/b43-24+,44-26+,45-28+,46-30+,47-32+,48-34+,49-36+,50-40+ |
| InChIKey | WCRXHNIUHQUASO-UVZVDVBNSA-N |
| SMILES | CC1=C(C(=O)C2=CC=CC=C2C1=O)C/C=C(\C)/CC/C=C(\C)/CC/C=C(\C)/CC/C=C(\C)/CC/C=C(\C)/CC/C=C(\C)/CC/C=C(\C)/CC/C=C(\C)/CCC=C(C)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
