For research use only. Not for therapeutic Use.
Menaquinone-4 2,3-epoxide (Cat No.: R054171) is an oxidized derivative of menaquinone-4 (vitamin K₂), featuring an epoxide group across the 2 and 3 positions of the naphthoquinone ring. With the molecular formula C₃₁H₄₆O₄, it plays a role in the vitamin K cycle, a biochemical pathway essential for the γ-carboxylation of specific glutamate residues in blood clotting factors. This epoxide form is reduced back to the active quinone by vitamin K epoxide reductase (VKOR), making it a key intermediate in coagulation and vitamin K metabolism research.
CAS Number | 72908-86-2 |
Synonyms | 1a,7a-Dihydro-1a-methyl-7a-[(2E,6E,10E)-3,7,11,15-tetramethyl-2,6,10,14-hexadecatetraen-1-yl]-naphth[2,3-b]oxirene-2,7-dione; (E,E,E)-1a,7a-Dihydro-1a-methyl-7a-?(3,7,11,15-tetramethyl-2,6,10,14-hexadecatetraenyl)naphth[2,3-b]oxirene-2,7-dione; ?Men |
Molecular Formula | C31H40O3 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 7a-methyl-1a-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]naphtho[2,3-b]oxirene-2,7-dione |
InChI | InChI=1S/C31H40O3/c1-22(2)12-9-13-23(3)14-10-15-24(4)16-11-17-25(5)20-21-31-29(33)27-19-8-7-18-26(27)28(32)30(31,6)34-31/h7-8,12,14,16,18-20H,9-11,13,15,17,21H2,1-6H3/b23-14+,24-16+,25-20+ |
InChIKey | TUZHANAISKEZFG-GHDNBGIDSA-N |
SMILES | CC(=CCCC(=CCCC(=CCCC(=CCC12C(=O)C3=CC=CC=C3C(=O)C1(O2)C)C)C)C)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |