For research use only. Not for therapeutic Use.
Meldrum’s acid (Cat No.:R010864) is a versatile cyclic compound widely used in organic synthesis due to its highly reactive methylene group flanked by two electron-withdrawing carbonyls. It serves as a precursor for barbiturates, heterocycles, and acylating agents, and is commonly used in the synthesis of β-keto esters, aldehydes, and ketones. Meldrum’s acid readily undergoes nucleophilic substitution, condensation, and thermal decarboxylation reactions. Appearing as a white crystalline solid, it is soluble in organic solvents and plays a valuable role in synthetic strategy development, particularly in combinatorial and medicinal chemistry.
| CAS Number | 2033-24-1 |
| Synonyms | 2,2-Dimethyl-1,3-dioxane-4,6-dione; 2,2-Propanediol Cyclic Malonate; Cyclic Isopropylidene Malonate; Isopropylidene Malonate; Meldrumic Acid; NSC 688343; NSC 71902; |
| Molecular Formula | C6H8O4 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 2,2-dimethyl-1,3-dioxane-4,6-dione |
| InChI | InChI=1S/C6H8O4/c1-6(2)9-4(7)3-5(8)10-6/h3H2,1-2H3 |
| InChIKey | GXHFUVWIGNLZSC-UHFFFAOYSA-N |
| SMILES | CC1(OC(=O)CC(=O)O1)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |