For research use only. Not for therapeutic Use.
MEK inhibitor is a potent MEK inhibitor with antitumor potency.
MEK inhibitor is a potent MEK inhibitor. MEK is a kinase enzyme which phosphorylates MAPKs. The activated MAPK leads to the phosphorylation of downstream transcription factors that regulate various responses such as stress signaling, pathogen response, and hormone signaling.
| CAS Number | 334951-92-7 |
| Synonyms | 3-[N-[3-[(dimethylamino)methyl]phenyl]-C-phenylcarbonimidoyl]-2-hydroxy-N-methyl-1H-indole-6-carboxamide |
| Molecular Formula | C26H26N4O2 |
| Purity | ≥95% |
| InChI | InChI=1S/C26H26N4O2/c1-27-25(31)19-12-13-21-22(15-19)29-26(32)23(21)24(18-9-5-4-6-10-18)28-20-11-7-8-17(14-20)16-30(2)3/h4-15,29,32H,16H2,1-3H3,(H,27,31) |
| InChIKey | UPICVLXBXZXYIE-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1=CC2=C(C=C1)C(=C(N2)O)C(=NC3=CC=CC(=C3)CN(C)C)C4=CC=CC=C4 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
