For research use only. Not for therapeutic Use.
Mebutizide (Cat.No:R057176) is an antihypertensive medication belonging to the thiazide diuretic class. It works by increasing urine production, thereby reducing blood volume and lowering blood pressure. Mebutizide is prescribed to manage hypertension and edema associated with heart failure. It’s considered effective and well-tolerated in many patients.
| CAS Number | 3568-00-1 |
| Synonyms | 6-Chloro-3,4-dihydro-3-(1,2-dimethylbutyl)-2H-1,2,4-benzothiadiazine-7-sulfonamide-1,1-dioxide; 6-Chloro-3-(1,2-dimethylbutyl)-7-sulfamyl-3,4-dihydro-1,2,4-benzothiadiazine-1,1-dioxide; Mebuthiazide; Mebutizid; Neoniagar; |
| Molecular Formula | C13H20ClN3O4S2 |
| Purity | ≥95% |
| Storage | Store at +4C |
| IUPAC Name | 6-chloro-3-(3-methylpentan-2-yl)-1,1-dioxo-3,4-dihydro-2H-1$l^{6} |
| InChI | InChI=1S/C13H20ClN3O4S2/c1-4-7(2)8(3)13-16-10-5-9(14)11(22(15,18)19)6-12(10)23(20,21)17-13/h5-8,13,16-17H,4H2,1-3H3,(H2,15,18,19) |
| InChIKey | KJLLKLRVCJAFRY-UHFFFAOYSA-N |
| SMILES | CCC(C)C(C)C1NC2=CC(=C(C=C2S(=O)(=O)N1)S(=O)(=O)N)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |