For research use only. Not for therapeutic Use.
MeBIO (Cat.No:I010839) iis a versatile biochemical reagent used in various research applications, particularly in the study of biological molecules. It is a methylated derivative of the bioactive compound inosine, offering enhanced stability and functional properties for nucleic acid research. Ideal for RNA modification studies, MeBIO plays a crucial role in examining RNA structure, interactions, and cellular processes. With its high purity and reliable performance, MeBIO is a valuable tool for scientists working in gene expression, RNA processing, and molecular biology.
| CAS Number | 667463-95-8 |
| Synonyms | (2’Z,3’E)-6-Bromo-1-methylindirubin-3/’-oxime |
| Molecular Formula | C17H12BrN3O2 |
| Purity | ≥95% |
| Target | Stem Cell/Wnt |
| Solubility | Soluble to 10 mM in DMSO |
| Storage | Store at +4°C |
| IUPAC Name | 6-bromo-1-methyl-3-(3-nitroso-1H-indol-2-yl)indol-2-ol |
| InChI | 1S/C17H12BrN3O2/c1-21-13-8-9(18)6-7-11(13)14(17(21)22)16-15(20-23)10-4-2-3-5-12(10)19-16/h2-8,19,22H,1H3 |
| InChIKey | JUKQKURGZYNHFN-NVVUQHMZSA-N |
| SMILES | CN1C2=C(C=CC(=C2)Br)C(=C1O)C3=C(C4=CC=CC=C4N3)N=O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |