For research use only. Not for therapeutic Use.
Mebendazole-amine（Cat No.:R013208）is a derivative of the widely known anthelmintic drug mebendazole, structurally modified to explore enhanced pharmacological activities. While mebendazole primarily disrupts microtubule formation in parasitic worms, its amine derivative has gained attention for potential anticancer properties. Studies suggest mebendazole-amine may inhibit tubulin polymerization, impair cell division, and trigger apoptosis in tumor cells. It also shows promise in overcoming solubility and bioavailability limitations associated with mebendazole. As a result, mebendazole-amine is being investigated as a research compound for oncology and drug development studies.
| CAS Number | 52329-60-9 |
| Synonyms | (2-amino-3H-benzimidazol-5-yl)-phenylmethanone |
| Molecular Formula | C14H11N3O |
| Purity | ≥95% |
| IUPAC Name | (2-amino-3H-benzimidazol-5-yl)-phenylmethanone |
| InChI | InChI=1S/C14H11N3O/c15-14-16-11-7-6-10(8-12(11)17-14)13(18)9-4-2-1-3-5-9/h1-8H,(H3,15,16,17) |
| InChIKey | GPMHHSJZGVOEFS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC3=C(C=C2)N=C(N3)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
