For research use only. Not for therapeutic Use.
MBD (Cat No.:I045254) refers to a conserved protein domain that recognizes and binds methylated cytosines in CpG dinucleotides within DNA. MBD-containing proteins, such as MeCP2, MBD1, and MBD2, play crucial roles in epigenetic regulation by recruiting chromatin remodeling complexes and histone-modifying enzymes to methylated DNA, leading to transcriptional repression or activation. MBD is essential in processes like gene silencing, X-chromosome inactivation, and genomic imprinting. Dysregulation of MBD function is linked to neurological disorders, cancer, and developmental diseases, making it a key focus in epigenetics and therapeutic research targeting DNA methylation pathways.
| CAS Number | 33984-50-8 |
| Synonyms | N-[(4-methoxyphenyl)methyl]-4-nitro-2,1,3-benzoxadiazol-7-amine |
| Molecular Formula | C14H12N4O4 |
| Purity | ≥95% |
| IUPAC Name | N-[(4-methoxyphenyl)methyl]-4-nitro-2,1,3-benzoxadiazol-7-amine |
| InChI | InChI=1S/C14H12N4O4/c1-21-10-4-2-9(3-5-10)8-15-11-6-7-12(18(19)20)14-13(11)16-22-17-14/h2-7,15H,8H2,1H3 |
| InChIKey | IENONFJSMWUIQQ-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)CNC2=CC=C(C3=NON=C23)[N+](=O)[O-] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
