For research use only. Not for therapeutic Use.
MAT2A Inhibitor 4（Cat No.:I044389）is a selective small-molecule inhibitor targeting methionine adenosyltransferase 2A (MAT2A), an enzyme crucial for S-adenosylmethionine (SAM) synthesis and methylation-dependent epigenetic regulation. By blocking MAT2A, this compound disrupts the methylation processes essential for tumor cell survival, especially in cancers with methylthioadenosine phosphorylase (MTAP) deletion. MAT2A Inhibitor 4 exhibits potent antitumor activity, selectively targeting MTAP-deficient tumor cells while sparing normal tissues. It is a valuable tool for studying methionine metabolism and epigenetic vulnerabilities in cancer, supporting the development of targeted therapies for genetically defined malignancies.
| CAS Number | 1391934-91-0 |
| Synonyms | 4-[(E)-2-(2-chloro-6-fluorophenyl)ethenyl]-N,N-dimethylaniline |
| Molecular Formula | C16H15ClFN |
| Purity | ≥95% |
| IUPAC Name | 4-[(E)-2-(2-chloro-6-fluorophenyl)ethenyl]-N,N-dimethylaniline |
| InChI | InChI=1S/C16H15ClFN/c1-19(2)13-9-6-12(7-10-13)8-11-14-15(17)4-3-5-16(14)18/h3-11H,1-2H3/b11-8+ |
| InChIKey | ZAXUUHSGXRGGON-DHZHZOJOSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)/C=C/C2=C(C=CC=C2Cl)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
