For research use only. Not for therapeutic Use.
MAT2A inhibitor 3(Cat No.:I044448)is a selective small-molecule inhibitor targeting methionine adenosyltransferase 2A (MAT2A), an enzyme responsible for synthesizing S-adenosylmethionine (SAM), a universal methyl donor involved in epigenetic regulation and cellular metabolism. By inhibiting MAT2A, this compound reduces SAM production, thereby modulating DNA and histone methylation in cancer cells—particularly those with MTAP (methylthioadenosine phosphorylase) deletions. MAT2A inhibitor 3 has demonstrated antiproliferative effects in MTAP-deficient tumor models, making it a valuable tool in precision oncology research. It supports therapeutic development targeting cancer-specific metabolic vulnerabilities and epigenetic dysregulation.
| CAS Number | 2439271-82-4 |
| Synonyms | 7-chloro-4-(dimethylamino)-1-phenylquinazolin-2-one |
| Molecular Formula | C16H14ClN3O |
| Purity | ≥95% |
| IUPAC Name | 7-chloro-4-(dimethylamino)-1-phenylquinazolin-2-one |
| InChI | InChI=1S/C16H14ClN3O/c1-19(2)15-13-9-8-11(17)10-14(13)20(16(21)18-15)12-6-4-3-5-7-12/h3-10H,1-2H3 |
| InChIKey | JMLJEYLWRAPHBL-UHFFFAOYSA-N |
| SMILES | CN(C)C1=NC(=O)N(C2=C1C=CC(=C2)Cl)C3=CC=CC=C3 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |